C21H19N3O2S — CID 23988869
8-(4-ethoxyphenyl)-2-(3-methoxyphenyl)-1H-imidazo[1,2-c]pyrimidine-5-thione (PubChem CID 23988869) has the molecular formula C21H19N3O2S and a molecular weight of 377.47 g/mol. Its IUPAC name is 8-(4-ethoxyphenyl)-2-(3-methoxyphenyl)-1H-imidazo[1,2-c]pyrimidine-5-thione.
| Compound Name | 8-(4-ethoxyphenyl)-2-(3-methoxyphenyl)-1H-imidazo[1,2-c]pyrimidine-5-thione |
|---|---|
| PubChem CID | 23988869 |
| Molecular Formula | C21H19N3O2S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 8-(4-ethoxyphenyl)-2-(3-methoxyphenyl)-1H-imidazo[1,2-c]pyrimidine-5-thione |
| SMILES | CCOc1ccc(-c2cnc(=S)n3cc(-c4cccc(OC)c4)[nH]c23)cc1 |
| InChI | InChI=1S/C21H19N3O2S/c1-3-26-16-9-7-14(8-10-16)18-12-22-21(27)24-13-19(23-20(18)24)15-5-4-6-17(11-15)25-2/h4-13,23H,3H2,1-2H3 |
| InChIKey | QOJOMILCOXXVKM-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 51.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|