C20H17N3S — CID 23931505
8-(3-methylphenyl)-2-(4-methylphenyl)-1H-imidazo[1,2-c]pyrimidine-5-thione (PubChem CID 23931505) has the molecular formula C20H17N3S and a molecular weight of 331.44 g/mol. Its IUPAC name is 8-(3-methylphenyl)-2-(4-methylphenyl)-1H-imidazo[1,2-c]pyrimidine-5-thione.
| Compound Name | 8-(3-methylphenyl)-2-(4-methylphenyl)-1H-imidazo[1,2-c]pyrimidine-5-thione |
|---|---|
| PubChem CID | 23931505 |
| Molecular Formula | C20H17N3S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 8-(3-methylphenyl)-2-(4-methylphenyl)-1H-imidazo[1,2-c]pyrimidine-5-thione |
| SMILES | Cc1ccc(-c2cn3c(=S)ncc(-c4cccc(C)c4)c3[nH]2)cc1 |
| InChI | InChI=1S/C20H17N3S/c1-13-6-8-15(9-7-13)18-12-23-19(22-18)17(11-21-20(23)24)16-5-3-4-14(2)10-16/h3-12,22H,1-2H3 |
| InChIKey | OITZYIIUGPVZNB-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|