C24H16ClN3S — CID 23958761
8-(4-chlorophenyl)-2-(4-phenylphenyl)-1H-imidazo[1,2-c]pyrimidine-5-thione (PubChem CID 23958761) has the molecular formula C24H16ClN3S and a molecular weight of 413.93 g/mol. Its IUPAC name is 8-(4-chlorophenyl)-2-(4-phenylphenyl)-1H-imidazo[1,2-c]pyrimidine-5-thione.
| Compound Name | 8-(4-chlorophenyl)-2-(4-phenylphenyl)-1H-imidazo[1,2-c]pyrimidine-5-thione |
|---|---|
| PubChem CID | 23958761 |
| Molecular Formula | C24H16ClN3S |
| Molecular Weight | 413.93 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | 8-(4-chlorophenyl)-2-(4-phenylphenyl)-1H-imidazo[1,2-c]pyrimidine-5-thione |
| SMILES | S=c1ncc(-c2ccc(Cl)cc2)c2[nH]c(-c3ccc(-c4ccccc4)cc3)cn12 |
| InChI | InChI=1S/C24H16ClN3S/c25-20-12-10-18(11-13-20)21-14-26-24(29)28-15-22(27-23(21)28)19-8-6-17(7-9-19)16-4-2-1-3-5-16/h1-15,27H |
| InChIKey | QKRFYRZNMCKQGH-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.93 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|