C19H13ClN4O2S — CID 23762521
2-(3-chloro-2-methylphenyl)-8-(4-nitrophenyl)-1H-imidazo[1,2-c]pyrimidine-5-thione (PubChem CID 23762521) has the molecular formula C19H13ClN4O2S and a molecular weight of 396.86 g/mol. Its IUPAC name is 2-(3-chloro-2-methylphenyl)-8-(4-nitrophenyl)-1H-imidazo[1,2-c]pyrimidine-5-thione.
| Compound Name | 2-(3-chloro-2-methylphenyl)-8-(4-nitrophenyl)-1H-imidazo[1,2-c]pyrimidine-5-thione |
|---|---|
| PubChem CID | 23762521 |
| Molecular Formula | C19H13ClN4O2S |
| Molecular Weight | 396.86 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | 2-(3-chloro-2-methylphenyl)-8-(4-nitrophenyl)-1H-imidazo[1,2-c]pyrimidine-5-thione |
| SMILES | Cc1c(Cl)cccc1-c1cn2c(=S)ncc(-c3ccc([N+](=O)[O-])cc3)c2[nH]1 |
| InChI | InChI=1S/C19H13ClN4O2S/c1-11-14(3-2-4-16(11)20)17-10-23-18(22-17)15(9-21-19(23)27)12-5-7-13(8-6-12)24(25)26/h2-10,22H,1H3 |
| InChIKey | XMXIMQLPSJTIMK-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.86 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|