C25H18ClN3S — CID 23907328
8-(3-chloro-4-methylphenyl)-2-(4-phenylphenyl)-1H-imidazo[1,2-c]pyrimidine-5-thione (PubChem CID 23907328) has the molecular formula C25H18ClN3S and a molecular weight of 427.96 g/mol. Its IUPAC name is 8-(3-chloro-4-methylphenyl)-2-(4-phenylphenyl)-1H-imidazo[1,2-c]pyrimidine-5-thione.
| Compound Name | 8-(3-chloro-4-methylphenyl)-2-(4-phenylphenyl)-1H-imidazo[1,2-c]pyrimidine-5-thione |
|---|---|
| PubChem CID | 23907328 |
| Molecular Formula | C25H18ClN3S |
| Molecular Weight | 427.96 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | 8-(3-chloro-4-methylphenyl)-2-(4-phenylphenyl)-1H-imidazo[1,2-c]pyrimidine-5-thione |
| SMILES | Cc1ccc(-c2cnc(=S)n3cc(-c4ccc(-c5ccccc5)cc4)[nH]c23)cc1Cl |
| InChI | InChI=1S/C25H18ClN3S/c1-16-7-8-20(13-22(16)26)21-14-27-25(30)29-15-23(28-24(21)29)19-11-9-18(10-12-19)17-5-3-2-4-6-17/h2-15,28H,1H3 |
| InChIKey | IFOGQSCCMQYQCE-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.96 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|