C20H15Cl2N3S — CID 23939082
8-(3,4-dichlorophenyl)-2-(3,4-dimethylphenyl)-1H-imidazo[1,2-c]pyrimidine-5-thione (PubChem CID 23939082) has the molecular formula C20H15Cl2N3S and a molecular weight of 400.33 g/mol. Its IUPAC name is 8-(3,4-dichlorophenyl)-2-(3,4-dimethylphenyl)-1H-imidazo[1,2-c]pyrimidine-5-thione.
| Compound Name | 8-(3,4-dichlorophenyl)-2-(3,4-dimethylphenyl)-1H-imidazo[1,2-c]pyrimidine-5-thione |
|---|---|
| PubChem CID | 23939082 |
| Molecular Formula | C20H15Cl2N3S |
| Molecular Weight | 400.33 g/mol |
| Exact Mass | 399.04 |
| IUPAC Name | 8-(3,4-dichlorophenyl)-2-(3,4-dimethylphenyl)-1H-imidazo[1,2-c]pyrimidine-5-thione |
| SMILES | Cc1ccc(-c2cn3c(=S)ncc(-c4ccc(Cl)c(Cl)c4)c3[nH]2)cc1C |
| InChI | InChI=1S/C20H15Cl2N3S/c1-11-3-4-14(7-12(11)2)18-10-25-19(24-18)15(9-23-20(25)26)13-5-6-16(21)17(22)8-13/h3-10,24H,1-2H3 |
| InChIKey | UNBPIAKYBUYERO-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.33 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|