C24H21IrN2- — CID 154596246
5-(2,6-dimethylphenyl)-2-[2-(3-methylphenyl)benzene-6-id-1-yl]-1H-imidazole;iridium (PubChem CID 154596246) has the molecular formula C24H21IrN2- and a molecular weight of 529.66 g/mol. Its IUPAC name is 5-(2,6-dimethylphenyl)-2-[2-(3-methylphenyl)benzene-6-id-1-yl]-1H-imidazole;iridium.
| Compound Name | 5-(2,6-dimethylphenyl)-2-[2-(3-methylphenyl)benzene-6-id-1-yl]-1H-imidazole;iridium |
|---|---|
| PubChem CID | 154596246 |
| Molecular Formula | C24H21IrN2- |
| Molecular Weight | 529.66 g/mol |
| Exact Mass | 530.13 |
| IUPAC Name | 5-(2,6-dimethylphenyl)-2-[2-(3-methylphenyl)benzene-6-id-1-yl]-1H-imidazole;iridium |
| SMILES | Cc1cccc(-c2ccc[c-]c2-c2ncc(-c3c(C)cccc3C)[nH]2)c1.[Ir] |
| InChI | InChI=1S/C24H21N2.Ir/c1-16-8-6-11-19(14-16)20-12-4-5-13-21(20)24-25-15-22(26-24)23-17(2)9-7-10-18(23)3;/h4-12,14-15H,1-3H3,(H,25,26);/q-1; |
| InChIKey | IXJHHYAADLNYAW-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.66 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|