C14H13Cl — CID 141199898
2-chloro-1-methyl-3-(3-methylphenyl)benzene (PubChem CID 141199898) has the molecular formula C14H13Cl and a molecular weight of 216.71 g/mol. Its IUPAC name is 2-chloro-1-methyl-3-(3-methylphenyl)benzene.
| Compound Name | 2-chloro-1-methyl-3-(3-methylphenyl)benzene |
|---|---|
| PubChem CID | 141199898 |
| Molecular Formula | C14H13Cl |
| Molecular Weight | 216.71 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 2-chloro-1-methyl-3-(3-methylphenyl)benzene |
| SMILES | Cc1cccc(-c2cccc(C)c2Cl)c1 |
| InChI | InChI=1S/C14H13Cl/c1-10-5-3-7-12(9-10)13-8-4-6-11(2)14(13)15/h3-9H,1-2H3 |
| InChIKey | SYALHCIPEXUGNT-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.71 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |