C17H18N2O3 — CID 173054294
3-(4-ethoxyphenyl)-5-(3-methoxyphenyl)-2H-1,3,4-oxadiazole (PubChem CID 173054294) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is 3-(4-ethoxyphenyl)-5-(3-methoxyphenyl)-2H-1,3,4-oxadiazole.
| Compound Name | 3-(4-ethoxyphenyl)-5-(3-methoxyphenyl)-2H-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 173054294 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 3-(4-ethoxyphenyl)-5-(3-methoxyphenyl)-2H-1,3,4-oxadiazole |
| SMILES | CCOc1ccc(N2COC(c3cccc(OC)c3)=N2)cc1 |
| InChI | InChI=1S/C17H18N2O3/c1-3-21-15-9-7-14(8-10-15)19-12-22-17(18-19)13-5-4-6-16(11-13)20-2/h4-11H,3,12H2,1-2H3 |
| InChIKey | INDKARDFJWWDKC-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 43.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |