C23H24N2O2S — CID 18880303
1-(4-ethoxyphenyl)-2-(3-methoxyphenyl)-5,6,7,8-tetrahydroquinazoline-4-thione (PubChem CID 18880303) has the molecular formula C23H24N2O2S and a molecular weight of 392.52 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-2-(3-methoxyphenyl)-5,6,7,8-tetrahydroquinazoline-4-thione.
| Compound Name | 1-(4-ethoxyphenyl)-2-(3-methoxyphenyl)-5,6,7,8-tetrahydroquinazoline-4-thione |
|---|---|
| PubChem CID | 18880303 |
| Molecular Formula | C23H24N2O2S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 1-(4-ethoxyphenyl)-2-(3-methoxyphenyl)-5,6,7,8-tetrahydroquinazoline-4-thione |
| SMILES | CCOc1ccc(-n2c(-c3cccc(OC)c3)nc(=S)c3c2CCCC3)cc1 |
| InChI | InChI=1S/C23H24N2O2S/c1-3-27-18-13-11-17(12-14-18)25-21-10-5-4-9-20(21)23(28)24-22(25)16-7-6-8-19(15-16)26-2/h6-8,11-15H,3-5,9-10H2,1-2H3 |
| InChIKey | RCEMJIUCZYVPMS-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|