C18H21N5O — CID 10448877
6,6-dimethyl-1-(4-phenylmethoxyphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 10448877) has the molecular formula C18H21N5O and a molecular weight of 323.40 g/mol. Its IUPAC name is 6,6-dimethyl-1-(4-phenylmethoxyphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6,6-dimethyl-1-(4-phenylmethoxyphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 10448877 |
| Molecular Formula | C18H21N5O |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 6,6-dimethyl-1-(4-phenylmethoxyphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CC1(C)N=C(N)N=C(N)N1c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C18H21N5O/c1-18(2)22-16(19)21-17(20)23(18)14-8-10-15(11-9-14)24-12-13-6-4-3-5-7-13/h3-11H,12H2,1-2H3,(H4,19,20,21,22) |
| InChIKey | HUTXUOTUXFTILM-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 89.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |