C16H10N4OS — CID 11748777
2-phenyl-5-phenyliminoimidazo[2,1-b][1,3,4]thiadiazol-6-one (PubChem CID 11748777) has the molecular formula C16H10N4OS and a molecular weight of 306.35 g/mol. Its IUPAC name is 2-phenyl-5-phenyliminoimidazo[2,1-b][1,3,4]thiadiazol-6-one.
| Compound Name | 2-phenyl-5-phenyliminoimidazo[2,1-b][1,3,4]thiadiazol-6-one |
|---|---|
| PubChem CID | 11748777 |
| Molecular Formula | C16H10N4OS |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 2-phenyl-5-phenyliminoimidazo[2,1-b][1,3,4]thiadiazol-6-one |
| SMILES | O=C1N=C2SC(c3ccccc3)=NN2/C1=N/c1ccccc1 |
| InChI | InChI=1S/C16H10N4OS/c21-14-13(17-12-9-5-2-6-10-12)20-16(18-14)22-15(19-20)11-7-3-1-4-8-11/h1-10H/b17-13+ |
| InChIKey | OZSNLVBOSBGJCZ-GHRIWEEISA-N |
| XLogP | 3.02 |
| TPSA | 57.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|