About bromobenzene;cyclohexa-2,5-diene-1,4-dione
bromobenzene;cyclohexa-2,5-diene-1,4-dione (PubChem CID 174480452) has the molecular formula C12H9BrO2
and a molecular weight of 265.11 g/mol. Its IUPAC name is bromobenzene;cyclohexa-2,5-diene-1,4-dione.
Molecular Properties
| Compound Name | bromobenzene;cyclohexa-2,5-diene-1,4-dione |
| PubChem CID | 174480452 |
| Molecular Formula | C12H9BrO2 |
| Molecular Weight | 265.11 g/mol |
| Exact Mass | 263.98 |
| IUPAC Name | bromobenzene;cyclohexa-2,5-diene-1,4-dione |
| SMILES | Brc1ccccc1.O=C1C=CC(=O)C=C1 |
| InChI | InChI=1S/C6H5Br.C6H4O2/c7-6-4-2-1-3-5-6;7-5-1-2-6(8)4-3-5/h1-5H;1-4H |
| InChIKey | SRRUTLOURLPLRP-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.11 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|
Analyze bromobenzene;cyclohexa-2,5-diene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromobenzene;cyclohexa-2,5-diene-1,4-dione?
The IUPAC name of bromobenzene;cyclohexa-2,5-diene-1,4-dione (CID 174480452) is bromobenzene;cyclohexa-2,5-diene-1,4-dione.
What is the SMILES notation for bromobenzene;cyclohexa-2,5-diene-1,4-dione?
The canonical SMILES for bromobenzene;cyclohexa-2,5-diene-1,4-dione is Brc1ccccc1.O=C1C=CC(=O)C=C1.
What is the InChIKey of bromobenzene;cyclohexa-2,5-diene-1,4-dione?
The InChIKey is SRRUTLOURLPLRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5Br.C6H4O2/c7-6-4-2-1-3-5-6;7-5-1-2-6(8)4-3-5/h1-5H;1-4H.
What are the key properties of bromobenzene;cyclohexa-2,5-diene-1,4-dione?
bromobenzene;cyclohexa-2,5-diene-1,4-dione has a molecular weight of 265.11 g/mol, XLogP of 2.70, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bromobenzene;cyclohexa-2,5-diene-1,4-dione is sourced from PubChem (CID 174480452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).