C12H9BrO2 — CID 174480452
bromobenzene;cyclohexa-2,5-diene-1,4-dione (PubChem CID 174480452) has the molecular formula C12H9BrO2 and a molecular weight of 265.11 g/mol. Its IUPAC name is bromobenzene;cyclohexa-2,5-diene-1,4-dione.
| Compound Name | bromobenzene;cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 174480452 |
| Molecular Formula | C12H9BrO2 |
| Molecular Weight | 265.11 g/mol |
| Exact Mass | 263.98 |
| IUPAC Name | bromobenzene;cyclohexa-2,5-diene-1,4-dione |
| SMILES | Brc1ccccc1.O=C1C=CC(=O)C=C1 |
| InChI | InChI=1S/C6H5Br.C6H4O2/c7-6-4-2-1-3-5-6;7-5-1-2-6(8)4-3-5/h1-5H;1-4H |
| InChIKey | SRRUTLOURLPLRP-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.11 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|