C18H16O4 — CID 67783364
cyclohexa-2,5-diene-1,4-dione;phenol (PubChem CID 67783364) has the molecular formula C18H16O4 and a molecular weight of 296.32 g/mol. Its IUPAC name is cyclohexa-2,5-diene-1,4-dione;phenol.
| Compound Name | cyclohexa-2,5-diene-1,4-dione;phenol |
|---|---|
| PubChem CID | 67783364 |
| Molecular Formula | C18H16O4 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | cyclohexa-2,5-diene-1,4-dione;phenol |
| SMILES | O=C1C=CC(=O)C=C1.Oc1ccccc1.Oc1ccccc1 |
| InChI | InChI=1S/C6H4O2.2C6H6O/c7-5-1-2-6(8)4-3-5;2*7-6-4-2-1-3-5-6/h1-4H;2*1-5,7H |
| InChIKey | ZZNBQSKJQLKAOK-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|