C12H10O4 — CID 7801
benzene-1,4-diol;cyclohexa-2,5-diene-1,4-dione (PubChem CID 7801) has the molecular formula C12H10O4 and a molecular weight of 218.21 g/mol. Its IUPAC name is benzene-1,4-diol;cyclohexa-2,5-diene-1,4-dione.
| Compound Name | benzene-1,4-diol;cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 7801 |
| Molecular Formula | C12H10O4 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | benzene-1,4-diol;cyclohexa-2,5-diene-1,4-dione |
| SMILES | O=C1C=CC(=O)C=C1.Oc1ccc(O)cc1 |
| InChI | InChI=1S/C6H6O2.C6H4O2/c2*7-5-1-2-6(8)4-3-5/h1-4,7-8H;1-4H |
| InChIKey | BDJXVNRFAQSMAA-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|