C18H19NO4S2 — CID 101421504
4-methyl-N-[oxo-[(E)-oxolan-2-ylidenemethyl]-phenyl-λ6-sulfanylidene]benzenesulfonamide (PubChem CID 101421504) has the molecular formula C18H19NO4S2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 4-methyl-N-[oxo-[(E)-oxolan-2-ylidenemethyl]-phenyl-λ6-sulfanylidene]benzenesulfonamide.
| Compound Name | 4-methyl-N-[oxo-[(E)-oxolan-2-ylidenemethyl]-phenyl-λ6-sulfanylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 101421504 |
| Molecular Formula | C18H19NO4S2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 4-methyl-N-[oxo-[(E)-oxolan-2-ylidenemethyl]-phenyl-λ6-sulfanylidene]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N=S(=O)(/C=C2\CCCO2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H19NO4S2/c1-15-9-11-18(12-10-15)25(21,22)19-24(20,14-16-6-5-13-23-16)17-7-3-2-4-8-17/h2-4,7-12,14H,5-6,13H2,1H3/b16-14+ |
| InChIKey | GBSCVSMSYVSGSQ-JQIJEIRASA-N |
| XLogP | 3.86 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |