C19H22INO2S — CID 149251410
N-(1-benzyl-1λ3-iodinan-2-ylidene)-4-methylbenzenesulfonamide (PubChem CID 149251410) has the molecular formula C19H22INO2S and a molecular weight of 455.36 g/mol. Its IUPAC name is N-(1-benzyl-1λ3-iodinan-2-ylidene)-4-methylbenzenesulfonamide.
| Compound Name | N-(1-benzyl-1λ3-iodinan-2-ylidene)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 149251410 |
| Molecular Formula | C19H22INO2S |
| Molecular Weight | 455.36 g/mol |
| Exact Mass | 455.04 |
| IUPAC Name | N-(1-benzyl-1λ3-iodinan-2-ylidene)-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N=C2CCCCI2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C19H22INO2S/c1-16-10-12-18(13-11-16)24(22,23)21-19-9-5-6-14-20(19)15-17-7-3-2-4-8-17/h2-4,7-8,10-13H,5-6,9,14-15H2,1H3 |
| InChIKey | WGGFBMHRBUPEAT-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.36 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|