C26H31NO3S — CID 177452105
(NZ)-N-[2-[cyclohexyl(phenylmethoxy)methyl]cyclopent-2-en-1-ylidene]-4-methylbenzenesulfonamide (PubChem CID 177452105) has the molecular formula C26H31NO3S and a molecular weight of 437.61 g/mol. Its IUPAC name is (NZ)-N-[2-[cyclohexyl(phenylmethoxy)methyl]cyclopent-2-en-1-ylidene]-4-methylbenzenesulfonamide.
| Compound Name | (NZ)-N-[2-[cyclohexyl(phenylmethoxy)methyl]cyclopent-2-en-1-ylidene]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 177452105 |
| Molecular Formula | C26H31NO3S |
| Molecular Weight | 437.61 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | (NZ)-N-[2-[cyclohexyl(phenylmethoxy)methyl]cyclopent-2-en-1-ylidene]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)/N=C2/CCC=C2C(OCc2ccccc2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C26H31NO3S/c1-20-15-17-23(18-16-20)31(28,29)27-25-14-8-13-24(25)26(22-11-6-3-7-12-22)30-19-21-9-4-2-5-10-21/h2,4-5,9-10,13,15-18,22,26H,3,6-8,11-12,14,19H2,1H3/b27-25- |
| InChIKey | PLWUYEMRCROVAV-RFBIWTDZSA-N |
| XLogP | 6.01 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.61 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|