C19H25ClN2O3S — CID 120714978
N-methyl-1-(4-phenylmethoxyphenyl)sulfonylpiperidin-3-amine;hydrochloride (PubChem CID 120714978) has the molecular formula C19H25ClN2O3S and a molecular weight of 396.94 g/mol. Its IUPAC name is N-methyl-1-(4-phenylmethoxyphenyl)sulfonylpiperidin-3-amine;hydrochloride.
| Compound Name | N-methyl-1-(4-phenylmethoxyphenyl)sulfonylpiperidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 120714978 |
| Molecular Formula | C19H25ClN2O3S |
| Molecular Weight | 396.94 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | N-methyl-1-(4-phenylmethoxyphenyl)sulfonylpiperidin-3-amine;hydrochloride |
| SMILES | CNC1CCCN(S(=O)(=O)c2ccc(OCc3ccccc3)cc2)C1.Cl |
| InChI | InChI=1S/C19H24N2O3S.ClH/c1-20-17-8-5-13-21(14-17)25(22,23)19-11-9-18(10-12-19)24-15-16-6-3-2-4-7-16;/h2-4,6-7,9-12,17,20H,5,8,13-15H2,1H3;1H |
| InChIKey | BTSUVZNPIAVVFH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.94 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |