C12H14N2O5S — CID 110739902
6-[(2-methyl-1,3-oxazinan-3-yl)sulfonyl]-3H-1,3-benzoxazol-2-one (PubChem CID 110739902) has the molecular formula C12H14N2O5S and a molecular weight of 298.32 g/mol. Its IUPAC name is 6-[(2-methyl-1,3-oxazinan-3-yl)sulfonyl]-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-[(2-methyl-1,3-oxazinan-3-yl)sulfonyl]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 110739902 |
| Molecular Formula | C12H14N2O5S |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 6-[(2-methyl-1,3-oxazinan-3-yl)sulfonyl]-3H-1,3-benzoxazol-2-one |
| SMILES | CC1OCCCN1S(=O)(=O)c1ccc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C12H14N2O5S/c1-8-14(5-2-6-18-8)20(16,17)9-3-4-10-11(7-9)19-12(15)13-10/h3-4,7-8H,2,5-6H2,1H3,(H,13,15) |
| InChIKey | VIFOOQKKAHKLTE-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 92.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |