C13H16N2O4S — CID 20866159
6-(3-methylpiperidin-1-yl)sulfonyl-3H-1,3-benzoxazol-2-one (PubChem CID 20866159) has the molecular formula C13H16N2O4S and a molecular weight of 296.35 g/mol. Its IUPAC name is 6-(3-methylpiperidin-1-yl)sulfonyl-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-(3-methylpiperidin-1-yl)sulfonyl-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 20866159 |
| Molecular Formula | C13H16N2O4S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 6-(3-methylpiperidin-1-yl)sulfonyl-3H-1,3-benzoxazol-2-one |
| SMILES | CC1CCCN(S(=O)(=O)c2ccc3[nH]c(=O)oc3c2)C1 |
| InChI | InChI=1S/C13H16N2O4S/c1-9-3-2-6-15(8-9)20(17,18)10-4-5-11-12(7-10)19-13(16)14-11/h4-5,7,9H,2-3,6,8H2,1H3,(H,14,16) |
| InChIKey | JJCILKTVHRZTPK-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |