C11H12N2O4S — CID 110760633
5-pyrrolidin-1-ylsulfonyl-3H-1,3-benzoxazol-2-one (PubChem CID 110760633) has the molecular formula C11H12N2O4S and a molecular weight of 268.29 g/mol. Its IUPAC name is 5-pyrrolidin-1-ylsulfonyl-3H-1,3-benzoxazol-2-one.
| Compound Name | 5-pyrrolidin-1-ylsulfonyl-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 110760633 |
| Molecular Formula | C11H12N2O4S |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 5-pyrrolidin-1-ylsulfonyl-3H-1,3-benzoxazol-2-one |
| SMILES | O=c1[nH]c2cc(S(=O)(=O)N3CCCC3)ccc2o1 |
| InChI | InChI=1S/C11H12N2O4S/c14-11-12-9-7-8(3-4-10(9)17-11)18(15,16)13-5-1-2-6-13/h3-4,7H,1-2,5-6H2,(H,12,14) |
| InChIKey | XVXMHOSWYAOKPB-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |