C14H18N2O5S — CID 110284519
6-(2,5,5-trimethylmorpholin-4-yl)sulfonyl-3H-1,3-benzoxazol-2-one (PubChem CID 110284519) has the molecular formula C14H18N2O5S and a molecular weight of 326.37 g/mol. Its IUPAC name is 6-(2,5,5-trimethylmorpholin-4-yl)sulfonyl-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-(2,5,5-trimethylmorpholin-4-yl)sulfonyl-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 110284519 |
| Molecular Formula | C14H18N2O5S |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 6-(2,5,5-trimethylmorpholin-4-yl)sulfonyl-3H-1,3-benzoxazol-2-one |
| SMILES | CC1CN(S(=O)(=O)c2ccc3[nH]c(=O)oc3c2)C(C)(C)CO1 |
| InChI | InChI=1S/C14H18N2O5S/c1-9-7-16(14(2,3)8-20-9)22(18,19)10-4-5-11-12(6-10)21-13(17)15-11/h4-6,9H,7-8H2,1-3H3,(H,15,17) |
| InChIKey | HCXOENYYVCMESX-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 92.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |