C14H21NO3S — CID 110740284
3-(4-tert-butylphenyl)sulfonyl-2-methyl-1,3-oxazolidine (PubChem CID 110740284) has the molecular formula C14H21NO3S and a molecular weight of 283.39 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)sulfonyl-2-methyl-1,3-oxazolidine.
| Compound Name | 3-(4-tert-butylphenyl)sulfonyl-2-methyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 110740284 |
| Molecular Formula | C14H21NO3S |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 3-(4-tert-butylphenyl)sulfonyl-2-methyl-1,3-oxazolidine |
| SMILES | CC1OCCN1S(=O)(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C14H21NO3S/c1-11-15(9-10-18-11)19(16,17)13-7-5-12(6-8-13)14(2,3)4/h5-8,11H,9-10H2,1-4H3 |
| InChIKey | FABZEWDCYJNFJB-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |