C14H21ClN2O2S — CID 98855875
(2R,3S)-1-(3-chloro-4-methylphenyl)sulfonyl-2,3,4-trimethylpiperazine (PubChem CID 98855875) has the molecular formula C14H21ClN2O2S and a molecular weight of 316.85 g/mol. Its IUPAC name is (2R,3S)-1-(3-chloro-4-methylphenyl)sulfonyl-2,3,4-trimethylpiperazine.
| Compound Name | (2R,3S)-1-(3-chloro-4-methylphenyl)sulfonyl-2,3,4-trimethylpiperazine |
|---|---|
| PubChem CID | 98855875 |
| Molecular Formula | C14H21ClN2O2S |
| Molecular Weight | 316.85 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | (2R,3S)-1-(3-chloro-4-methylphenyl)sulfonyl-2,3,4-trimethylpiperazine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(C)[C@@H](C)[C@H]2C)cc1Cl |
| InChI | InChI=1S/C14H21ClN2O2S/c1-10-5-6-13(9-14(10)15)20(18,19)17-8-7-16(4)11(2)12(17)3/h5-6,9,11-12H,7-8H2,1-4H3/t11-,12+/m0/s1 |
| InChIKey | URCZZRJGRLVZQI-NWDGAFQWSA-N |
| XLogP | 2.36 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.85 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |