C12H14Cl2N2O4S — CID 128977312
(2R,3S)-4-(3,4-dichlorophenyl)sulfonyl-2-methylmorpholine-3-carboxamide (PubChem CID 128977312) has the molecular formula C12H14Cl2N2O4S and a molecular weight of 353.23 g/mol. Its IUPAC name is (2R,3S)-4-(3,4-dichlorophenyl)sulfonyl-2-methylmorpholine-3-carboxamide.
| Compound Name | (2R,3S)-4-(3,4-dichlorophenyl)sulfonyl-2-methylmorpholine-3-carboxamide |
|---|---|
| PubChem CID | 128977312 |
| Molecular Formula | C12H14Cl2N2O4S |
| Molecular Weight | 353.23 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | (2R,3S)-4-(3,4-dichlorophenyl)sulfonyl-2-methylmorpholine-3-carboxamide |
| SMILES | C[C@H]1OCCN(S(=O)(=O)c2ccc(Cl)c(Cl)c2)[C@@H]1C(N)=O |
| InChI | InChI=1S/C12H14Cl2N2O4S/c1-7-11(12(15)17)16(4-5-20-7)21(18,19)8-2-3-9(13)10(14)6-8/h2-3,6-7,11H,4-5H2,1H3,(H2,15,17)/t7-,11+/m1/s1 |
| InChIKey | IFGQRTKVXOAPAO-HQJQHLMTSA-N |
| XLogP | 1.26 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.23 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |