C13H14Cl2N2O5S — CID 91537330
4-acetyl-1-(3,4-dichlorophenyl)sulfonylpiperazine-2-carboxylic acid (PubChem CID 91537330) has the molecular formula C13H14Cl2N2O5S and a molecular weight of 381.24 g/mol. Its IUPAC name is 4-acetyl-1-(3,4-dichlorophenyl)sulfonylpiperazine-2-carboxylic acid.
| Compound Name | 4-acetyl-1-(3,4-dichlorophenyl)sulfonylpiperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 91537330 |
| Molecular Formula | C13H14Cl2N2O5S |
| Molecular Weight | 381.24 g/mol |
| Exact Mass | 380.00 |
| IUPAC Name | 4-acetyl-1-(3,4-dichlorophenyl)sulfonylpiperazine-2-carboxylic acid |
| SMILES | CC(=O)N1CCN(S(=O)(=O)c2ccc(Cl)c(Cl)c2)C(C(=O)O)C1 |
| InChI | InChI=1S/C13H14Cl2N2O5S/c1-8(18)16-4-5-17(12(7-16)13(19)20)23(21,22)9-2-3-10(14)11(15)6-9/h2-3,6,12H,4-5,7H2,1H3,(H,19,20) |
| InChIKey | CQQHOQCZGOICOY-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.24 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |