C11H10Cl2NO5S- — CID 2078806
(2S,4R)-1-(3,4-dichlorophenyl)sulfonyl-4-hydroxypyrrolidine-2-carboxylate (PubChem CID 2078806) has the molecular formula C11H10Cl2NO5S- and a molecular weight of 339.18 g/mol. Its IUPAC name is (2S,4R)-1-(3,4-dichlorophenyl)sulfonyl-4-hydroxypyrrolidine-2-carboxylate.
| Compound Name | (2S,4R)-1-(3,4-dichlorophenyl)sulfonyl-4-hydroxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 2078806 |
| Molecular Formula | C11H10Cl2NO5S- |
| Molecular Weight | 339.18 g/mol |
| Exact Mass | 337.97 |
| IUPAC Name | (2S,4R)-1-(3,4-dichlorophenyl)sulfonyl-4-hydroxypyrrolidine-2-carboxylate |
| SMILES | O=C([O-])[C@@H]1C[C@@H](O)CN1S(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H11Cl2NO5S/c12-8-2-1-7(4-9(8)13)20(18,19)14-5-6(15)3-10(14)11(16)17/h1-2,4,6,10,15H,3,5H2,(H,16,17)/p-1/t6-,10+/m1/s1 |
| InChIKey | QJEYDAZODKHMTB-LDWIPMOCSA-M |
| XLogP | -0.13 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.18 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |