C13H15BrClNO4S — CID 106605662
1-(3-bromo-4-chlorophenyl)sulfonyl-4-methylpiperidine-2-carboxylic acid (PubChem CID 106605662) has the molecular formula C13H15BrClNO4S and a molecular weight of 396.69 g/mol. Its IUPAC name is 1-(3-bromo-4-chlorophenyl)sulfonyl-4-methylpiperidine-2-carboxylic acid.
| Compound Name | 1-(3-bromo-4-chlorophenyl)sulfonyl-4-methylpiperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 106605662 |
| Molecular Formula | C13H15BrClNO4S |
| Molecular Weight | 396.69 g/mol |
| Exact Mass | 394.96 |
| IUPAC Name | 1-(3-bromo-4-chlorophenyl)sulfonyl-4-methylpiperidine-2-carboxylic acid |
| SMILES | CC1CCN(S(=O)(=O)c2ccc(Cl)c(Br)c2)C(C(=O)O)C1 |
| InChI | InChI=1S/C13H15BrClNO4S/c1-8-4-5-16(12(6-8)13(17)18)21(19,20)9-2-3-11(15)10(14)7-9/h2-3,7-8,12H,4-6H2,1H3,(H,17,18) |
| InChIKey | COLQDBDIGXBTPN-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.69 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |