C18H27NO3S — CID 124829077
(4aS,8aS)-6-[3-(3-methylphenyl)sulfonylpropyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine (PubChem CID 124829077) has the molecular formula C18H27NO3S and a molecular weight of 337.48 g/mol. Its IUPAC name is (4aS,8aS)-6-[3-(3-methylphenyl)sulfonylpropyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine.
| Compound Name | (4aS,8aS)-6-[3-(3-methylphenyl)sulfonylpropyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine |
|---|---|
| PubChem CID | 124829077 |
| Molecular Formula | C18H27NO3S |
| Molecular Weight | 337.48 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | (4aS,8aS)-6-[3-(3-methylphenyl)sulfonylpropyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine |
| SMILES | Cc1cccc(S(=O)(=O)CCCN2CC[C@@H]3OCCC[C@H]3C2)c1 |
| InChI | InChI=1S/C18H27NO3S/c1-15-5-2-7-17(13-15)23(20,21)12-4-9-19-10-8-18-16(14-19)6-3-11-22-18/h2,5,7,13,16,18H,3-4,6,8-12,14H2,1H3/t16-,18-/m0/s1 |
| InChIKey | OBTFLDKGXBAKBH-WMZOPIPTSA-N |
| XLogP | 2.66 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.48 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |