C11H22N2O — CID 176638930
(4aS,7aS)-6-tert-butyl-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine (PubChem CID 176638930) has the molecular formula C11H22N2O and a molecular weight of 198.31 g/mol. Its IUPAC name is (4aS,7aS)-6-tert-butyl-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine.
| Compound Name | (4aS,7aS)-6-tert-butyl-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
|---|---|
| PubChem CID | 176638930 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | (4aS,7aS)-6-tert-butyl-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
| SMILES | CN1CCO[C@H]2CN(C(C)(C)C)C[C@@H]21 |
| InChI | InChI=1S/C11H22N2O/c1-11(2,3)13-7-9-10(8-13)14-6-5-12(9)4/h9-10H,5-8H2,1-4H3/t9-,10-/m0/s1 |
| InChIKey | RKICGMLDBXCTND-UWVGGRQHSA-N |
| XLogP | 0.80 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |