C6H13NO3S — CID 89262144
2,3-dimethylmorpholine-4-sulfinic acid (PubChem CID 89262144) has the molecular formula C6H13NO3S and a molecular weight of 179.24 g/mol. Its IUPAC name is 2,3-dimethylmorpholine-4-sulfinic acid.
| Compound Name | 2,3-dimethylmorpholine-4-sulfinic acid |
|---|---|
| PubChem CID | 89262144 |
| Molecular Formula | C6H13NO3S |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.06 |
| IUPAC Name | 2,3-dimethylmorpholine-4-sulfinic acid |
| SMILES | CC1OCCN(S(=O)O)C1C |
| InChI | InChI=1S/C6H13NO3S/c1-5-6(2)10-4-3-7(5)11(8)9/h5-6H,3-4H2,1-2H3,(H,8,9) |
| InChIKey | OXXSTTVLINFEJI-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|