About 3-amino-2-(2,3-dimethylmorpholin-4-yl)propan-1-ol
3-amino-2-(2,3-dimethylmorpholin-4-yl)propan-1-ol (PubChem CID 131209513) has the molecular formula C9H20N2O2
and a molecular weight of 188.27 g/mol. Its IUPAC name is 3-amino-2-(2,3-dimethylmorpholin-4-yl)propan-1-ol.
Molecular Properties
| Compound Name | 3-amino-2-(2,3-dimethylmorpholin-4-yl)propan-1-ol |
| PubChem CID | 131209513 |
| Molecular Formula | C9H20N2O2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.15 |
| IUPAC Name | 3-amino-2-(2,3-dimethylmorpholin-4-yl)propan-1-ol |
| SMILES | CC1OCCN(C(CN)CO)C1C |
| InChI | InChI=1S/C9H20N2O2/c1-7-8(2)13-4-3-11(7)9(5-10)6-12/h7-9,12H,3-6,10H2,1-2H3 |
| InChIKey | ROTUWQYRFDHTPS-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-2-(2,3-dimethylmorpholin-4-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-(2,3-dimethylmorpholin-4-yl)propan-1-ol?
The IUPAC name of 3-amino-2-(2,3-dimethylmorpholin-4-yl)propan-1-ol (CID 131209513) is 3-amino-2-(2,3-dimethylmorpholin-4-yl)propan-1-ol.
What is the SMILES notation for 3-amino-2-(2,3-dimethylmorpholin-4-yl)propan-1-ol?
The canonical SMILES for 3-amino-2-(2,3-dimethylmorpholin-4-yl)propan-1-ol is CC1OCCN(C(CN)CO)C1C.
What is the InChIKey of 3-amino-2-(2,3-dimethylmorpholin-4-yl)propan-1-ol?
The InChIKey is ROTUWQYRFDHTPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2O2/c1-7-8(2)13-4-3-11(7)9(5-10)6-12/h7-9,12H,3-6,10H2,1-2H3.
What are the key properties of 3-amino-2-(2,3-dimethylmorpholin-4-yl)propan-1-ol?
3-amino-2-(2,3-dimethylmorpholin-4-yl)propan-1-ol has a molecular weight of 188.27 g/mol, XLogP of -0.58, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-(2,3-dimethylmorpholin-4-yl)propan-1-ol is sourced from PubChem (CID 131209513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).