C12H27NO — CID 145070078
ethane;4-ethyl-2,3,5,6-tetramethylmorpholine (PubChem CID 145070078) has the molecular formula C12H27NO and a molecular weight of 201.35 g/mol. Its IUPAC name is ethane;4-ethyl-2,3,5,6-tetramethylmorpholine.
| Compound Name | ethane;4-ethyl-2,3,5,6-tetramethylmorpholine |
|---|---|
| PubChem CID | 145070078 |
| Molecular Formula | C12H27NO |
| Molecular Weight | 201.35 g/mol |
| Exact Mass | 201.21 |
| IUPAC Name | ethane;4-ethyl-2,3,5,6-tetramethylmorpholine |
| SMILES | CC.CCN1C(C)C(C)OC(C)C1C |
| InChI | InChI=1S/C10H21NO.C2H6/c1-6-11-7(2)9(4)12-10(5)8(11)3;1-2/h7-10H,6H2,1-5H3;1-2H3 |
| InChIKey | HRQDFKXNPPXHPS-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |