C12H29N — CID 159737660
(2R,3R,4S,5S)-1-ethyl-2,3,4,5-tetramethylpyrrolidine;methane (PubChem CID 159737660) has the molecular formula C12H29N and a molecular weight of 187.37 g/mol. Its IUPAC name is (2R,3R,4S,5S)-1-ethyl-2,3,4,5-tetramethylpyrrolidine;methane.
| Compound Name | (2R,3R,4S,5S)-1-ethyl-2,3,4,5-tetramethylpyrrolidine;methane |
|---|---|
| PubChem CID | 159737660 |
| Molecular Formula | C12H29N |
| Molecular Weight | 187.37 g/mol |
| Exact Mass | 187.23 |
| IUPAC Name | (2R,3R,4S,5S)-1-ethyl-2,3,4,5-tetramethylpyrrolidine;methane |
| SMILES | C.C.CCN1[C@H](C)[C@H](C)[C@H](C)[C@@H]1C |
| InChI | InChI=1S/C10H21N.2CH4/c1-6-11-9(4)7(2)8(3)10(11)5;;/h7-10H,6H2,1-5H3;2*1H4/t7-,8+,9-,10+;; |
| InChIKey | NCAQEULYHYFZSA-DHNWFJROSA-N |
| XLogP | 3.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.37 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |