C13H21N — CID 121385148
(1R,4S,5S,6R,7S)-3-ethyl-4,5-dimethyl-3-azatricyclo[5.3.0.02,6]dec-8-ene (PubChem CID 121385148) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is (1R,4S,5S,6R,7S)-3-ethyl-4,5-dimethyl-3-azatricyclo[5.3.0.02,6]dec-8-ene.
| Compound Name | (1R,4S,5S,6R,7S)-3-ethyl-4,5-dimethyl-3-azatricyclo[5.3.0.02,6]dec-8-ene |
|---|---|
| PubChem CID | 121385148 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | (1R,4S,5S,6R,7S)-3-ethyl-4,5-dimethyl-3-azatricyclo[5.3.0.02,6]dec-8-ene |
| SMILES | CCN1C2[C@@H]([C@H](C)[C@@H]1C)[C@H]1C=CC[C@@H]21 |
| InChI | InChI=1S/C13H21N/c1-4-14-9(3)8(2)12-10-6-5-7-11(10)13(12)14/h5-6,8-13H,4,7H2,1-3H3/t8-,9+,10+,11-,12+,13?/m1/s1 |
| InChIKey | ICKQVCTVMJFLFF-OPEPVNDTSA-N |
| XLogP | 2.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|