C18H32 — CID 145186061
ethane;4-methyltetracyclo[6.5.0.02,7.09,13]tridec-10-ene (PubChem CID 145186061) has the molecular formula C18H32 and a molecular weight of 248.45 g/mol. Its IUPAC name is ethane;4-methyltetracyclo[6.5.0.02,7.09,13]tridec-10-ene.
| Compound Name | ethane;4-methyltetracyclo[6.5.0.02,7.09,13]tridec-10-ene |
|---|---|
| PubChem CID | 145186061 |
| Molecular Formula | C18H32 |
| Molecular Weight | 248.45 g/mol |
| Exact Mass | 248.25 |
| IUPAC Name | ethane;4-methyltetracyclo[6.5.0.02,7.09,13]tridec-10-ene |
| SMILES | CC.CC.CC1CCC2C(C1)C1C3CC=CC3C21 |
| InChI | InChI=1S/C14H20.2C2H6/c1-8-5-6-11-12(7-8)14-10-4-2-3-9(10)13(11)14;2*1-2/h2-3,8-14H,4-7H2,1H3;2*1-2H3 |
| InChIKey | NLWOWZWLWOPKSA-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.45 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|