C14H20 — CID 145186062
4-methyltetracyclo[6.5.0.02,7.09,13]tridec-10-ene (PubChem CID 145186062) has the molecular formula C14H20 and a molecular weight of 188.31 g/mol. Its IUPAC name is 4-methyltetracyclo[6.5.0.02,7.09,13]tridec-10-ene.
| Compound Name | 4-methyltetracyclo[6.5.0.02,7.09,13]tridec-10-ene |
|---|---|
| PubChem CID | 145186062 |
| Molecular Formula | C14H20 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | 4-methyltetracyclo[6.5.0.02,7.09,13]tridec-10-ene |
| SMILES | CC1CCC2C(C1)C1C3CC=CC3C21 |
| InChI | InChI=1S/C14H20/c1-8-5-6-11-12(7-8)14-10-4-2-3-9(10)13(11)14/h2-3,8-14H,4-7H2,1H3 |
| InChIKey | VDSTVVXSHXDNRN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|