C14H29N — CID 118216160
(2S,3S,4S,5R,6R,7R)-1-ethyl-2,3,4,5,6,7-hexamethylazepane (PubChem CID 118216160) has the molecular formula C14H29N and a molecular weight of 211.39 g/mol. Its IUPAC name is (2S,3S,4S,5R,6R,7R)-1-ethyl-2,3,4,5,6,7-hexamethylazepane.
| Compound Name | (2S,3S,4S,5R,6R,7R)-1-ethyl-2,3,4,5,6,7-hexamethylazepane |
|---|---|
| PubChem CID | 118216160 |
| Molecular Formula | C14H29N |
| Molecular Weight | 211.39 g/mol |
| Exact Mass | 211.23 |
| IUPAC Name | (2S,3S,4S,5R,6R,7R)-1-ethyl-2,3,4,5,6,7-hexamethylazepane |
| SMILES | CCN1[C@H](C)[C@H](C)[C@H](C)[C@H](C)[C@H](C)[C@@H]1C |
| InChI | InChI=1S/C14H29N/c1-8-15-13(6)11(4)9(2)10(3)12(5)14(15)7/h9-14H,8H2,1-7H3/t9-,10+,11-,12+,13-,14+ |
| InChIKey | DTHLEVNLTPQNDX-LRRLDJKKSA-N |
| XLogP | 3.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |