C8H17NO3 — CID 19040214
3-ethyl-4,5-dimethoxy-2-methyl-1,3-oxazolidine (PubChem CID 19040214) has the molecular formula C8H17NO3 and a molecular weight of 175.23 g/mol. Its IUPAC name is 3-ethyl-4,5-dimethoxy-2-methyl-1,3-oxazolidine.
| Compound Name | 3-ethyl-4,5-dimethoxy-2-methyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 19040214 |
| Molecular Formula | C8H17NO3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | 3-ethyl-4,5-dimethoxy-2-methyl-1,3-oxazolidine |
| SMILES | CCN1C(C)OC(OC)C1OC |
| InChI | InChI=1S/C8H17NO3/c1-5-9-6(2)12-8(11-4)7(9)10-3/h6-8H,5H2,1-4H3 |
| InChIKey | ZPXXXQFSHLIEMI-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |