C10H21NSi — CID 174484597
(2-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)silane (PubChem CID 174484597) has the molecular formula C10H21NSi and a molecular weight of 183.37 g/mol. Its IUPAC name is (2-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)silane.
| Compound Name | (2-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)silane |
|---|---|
| PubChem CID | 174484597 |
| Molecular Formula | C10H21NSi |
| Molecular Weight | 183.37 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | (2-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)silane |
| SMILES | CC1CCC2CCCCC2N1[SiH3] |
| InChI | InChI=1S/C10H21NSi/c1-8-6-7-9-4-2-3-5-10(9)11(8)12/h8-10H,2-7H2,1,12H3 |
| InChIKey | NUFSHQIEMKRQIK-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.37 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|