C14H25NOS — CID 21484578
S-propan-2-yl 2-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbothioate (PubChem CID 21484578) has the molecular formula C14H25NOS and a molecular weight of 255.43 g/mol. Its IUPAC name is S-propan-2-yl 2-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbothioate.
| Compound Name | S-propan-2-yl 2-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbothioate |
|---|---|
| PubChem CID | 21484578 |
| Molecular Formula | C14H25NOS |
| Molecular Weight | 255.43 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | S-propan-2-yl 2-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbothioate |
| SMILES | CC(C)SC(=O)N1C(C)CCC2CCCCC21 |
| InChI | InChI=1S/C14H25NOS/c1-10(2)17-14(16)15-11(3)8-9-12-6-4-5-7-13(12)15/h10-13H,4-9H2,1-3H3 |
| InChIKey | DPTHIJZEEAIHDJ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.43 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|