C17H22N2O3 — CID 11913502
[(2R,4aS,8aS)-2-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(4-nitrophenyl)methanone (PubChem CID 11913502) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is [(2R,4aS,8aS)-2-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(4-nitrophenyl)methanone.
| Compound Name | [(2R,4aS,8aS)-2-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 11913502 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | [(2R,4aS,8aS)-2-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(4-nitrophenyl)methanone |
| SMILES | C[C@@H]1CC[C@@H]2CCCC[C@@H]2N1C(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H22N2O3/c1-12-6-7-13-4-2-3-5-16(13)18(12)17(20)14-8-10-15(11-9-14)19(21)22/h8-13,16H,2-7H2,1H3/t12-,13+,16+/m1/s1 |
| InChIKey | MOMLIPCTFFGVNI-WWGRRREGSA-N |
| XLogP | 3.78 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|