C14H23NO — CID 10198369
4-methyl-1,2,4,4a,5,6,6a,7,8,9,10,10a-dodecahydrobenzo[f]quinolizin-3-one (PubChem CID 10198369) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 4-methyl-1,2,4,4a,5,6,6a,7,8,9,10,10a-dodecahydrobenzo[f]quinolizin-3-one.
| Compound Name | 4-methyl-1,2,4,4a,5,6,6a,7,8,9,10,10a-dodecahydrobenzo[f]quinolizin-3-one |
|---|---|
| PubChem CID | 10198369 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 4-methyl-1,2,4,4a,5,6,6a,7,8,9,10,10a-dodecahydrobenzo[f]quinolizin-3-one |
| SMILES | CC1C(=O)CCN2C3CCCCC3CCC12 |
| InChI | InChI=1S/C14H23NO/c1-10-12-7-6-11-4-2-3-5-13(11)15(12)9-8-14(10)16/h10-13H,2-9H2,1H3 |
| InChIKey | GAQQIPZOKAMFOM-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |