C16H27NO2 — CID 63069545
2-(2-cyclopentylpyrrolidin-1-yl)cyclohexane-1-carboxylic acid (PubChem CID 63069545) has the molecular formula C16H27NO2 and a molecular weight of 265.40 g/mol. Its IUPAC name is 2-(2-cyclopentylpyrrolidin-1-yl)cyclohexane-1-carboxylic acid.
| Compound Name | 2-(2-cyclopentylpyrrolidin-1-yl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 63069545 |
| Molecular Formula | C16H27NO2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | 2-(2-cyclopentylpyrrolidin-1-yl)cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCCCC1N1CCCC1C1CCCC1 |
| InChI | InChI=1S/C16H27NO2/c18-16(19)13-8-3-4-9-15(13)17-11-5-10-14(17)12-6-1-2-7-12/h12-15H,1-11H2,(H,18,19) |
| InChIKey | XMQNKIIRTKRPGG-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |