C8H18N2O — CID 18685130
(4-amino-1,3-dimethylpiperidin-3-yl)methanol (PubChem CID 18685130) has the molecular formula C8H18N2O and a molecular weight of 158.24 g/mol. Its IUPAC name is (4-amino-1,3-dimethylpiperidin-3-yl)methanol.
| Compound Name | (4-amino-1,3-dimethylpiperidin-3-yl)methanol |
|---|---|
| PubChem CID | 18685130 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | (4-amino-1,3-dimethylpiperidin-3-yl)methanol |
| SMILES | CN1CCC(N)C(C)(CO)C1 |
| InChI | InChI=1S/C8H18N2O/c1-8(6-11)5-10(2)4-3-7(8)9/h7,11H,3-6,9H2,1-2H3 |
| InChIKey | ACLDKTUCZHNAEZ-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |