C10H24N2O — CID 177010134
ethane;(1,2,4-trimethylpiperazin-2-yl)methanol (PubChem CID 177010134) has the molecular formula C10H24N2O and a molecular weight of 188.31 g/mol. Its IUPAC name is ethane;(1,2,4-trimethylpiperazin-2-yl)methanol.
| Compound Name | ethane;(1,2,4-trimethylpiperazin-2-yl)methanol |
|---|---|
| PubChem CID | 177010134 |
| Molecular Formula | C10H24N2O |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.19 |
| IUPAC Name | ethane;(1,2,4-trimethylpiperazin-2-yl)methanol |
| SMILES | CC.CN1CCN(C)C(C)(CO)C1 |
| InChI | InChI=1S/C8H18N2O.C2H6/c1-8(7-11)6-9(2)4-5-10(8)3;1-2/h11H,4-7H2,1-3H3;1-2H3 |
| InChIKey | ASRMRDYLMZCDMK-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |