C13H19NO2 — CID 71056439
(3R,4R)-3-methoxy-1-methyl-4-phenylpiperidin-4-ol (PubChem CID 71056439) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is (3R,4R)-3-methoxy-1-methyl-4-phenylpiperidin-4-ol.
| Compound Name | (3R,4R)-3-methoxy-1-methyl-4-phenylpiperidin-4-ol |
|---|---|
| PubChem CID | 71056439 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | (3R,4R)-3-methoxy-1-methyl-4-phenylpiperidin-4-ol |
| SMILES | CO[C@@H]1CN(C)CC[C@@]1(O)c1ccccc1 |
| InChI | InChI=1S/C13H19NO2/c1-14-9-8-13(15,12(10-14)16-2)11-6-4-3-5-7-11/h3-7,12,15H,8-10H2,1-2H3/t12-,13-/m1/s1 |
| InChIKey | NWLOGPCMUDNMBX-CHWSQXEVSA-N |
| XLogP | 1.22 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |