C20H33N3O2 — CID 145013374
1-ethylpiperidine;N-(4-hydroxy-1-methyl-4-phenylpiperidin-3-yl)formamide (PubChem CID 145013374) has the molecular formula C20H33N3O2 and a molecular weight of 347.50 g/mol. Its IUPAC name is 1-ethylpiperidine;N-(4-hydroxy-1-methyl-4-phenylpiperidin-3-yl)formamide.
| Compound Name | 1-ethylpiperidine;N-(4-hydroxy-1-methyl-4-phenylpiperidin-3-yl)formamide |
|---|---|
| PubChem CID | 145013374 |
| Molecular Formula | C20H33N3O2 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.26 |
| IUPAC Name | 1-ethylpiperidine;N-(4-hydroxy-1-methyl-4-phenylpiperidin-3-yl)formamide |
| SMILES | CCN1CCCCC1.CN1CCC(O)(c2ccccc2)C(NC=O)C1 |
| InChI | InChI=1S/C13H18N2O2.C7H15N/c1-15-8-7-13(17,12(9-15)14-10-16)11-5-3-2-4-6-11;1-2-8-6-4-3-5-7-8/h2-6,10,12,17H,7-9H2,1H3,(H,14,16);2-7H2,1H3 |
| InChIKey | XOESUZJBMKWHNV-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|