C23H36N4O — CID 71932300
2-[3-(4-ethylpiperazin-1-yl)pyrrolidin-1-yl]-N-[(1-phenylcyclobutyl)methyl]acetamide (PubChem CID 71932300) has the molecular formula C23H36N4O and a molecular weight of 384.57 g/mol. Its IUPAC name is 2-[3-(4-ethylpiperazin-1-yl)pyrrolidin-1-yl]-N-[(1-phenylcyclobutyl)methyl]acetamide.
| Compound Name | 2-[3-(4-ethylpiperazin-1-yl)pyrrolidin-1-yl]-N-[(1-phenylcyclobutyl)methyl]acetamide |
|---|---|
| PubChem CID | 71932300 |
| Molecular Formula | C23H36N4O |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.29 |
| IUPAC Name | 2-[3-(4-ethylpiperazin-1-yl)pyrrolidin-1-yl]-N-[(1-phenylcyclobutyl)methyl]acetamide |
| SMILES | CCN1CCN(C2CCN(CC(=O)NCC3(c4ccccc4)CCC3)C2)CC1 |
| InChI | InChI=1S/C23H36N4O/c1-2-25-13-15-27(16-14-25)21-9-12-26(17-21)18-22(28)24-19-23(10-6-11-23)20-7-4-3-5-8-20/h3-5,7-8,21H,2,6,9-19H2,1H3,(H,24,28) |
| InChIKey | OMCXDKQMIIRUTF-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |